C22H22FN5O3 — CID 110244989
N-[2-[4-(2-fluoro-3-pyridinyl)-4-hydroxypiperidine-1-carbonyl]phenyl]-1-methylpyrazole-3-carboxamide (PubChem CID 110244989) has the molecular formula C22H22FN5O3 and a molecular weight of 423.45 g/mol. Its IUPAC name is N-[2-[4-(2-fluoro-3-pyridinyl)-4-hydroxypiperidine-1-carbonyl]phenyl]-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[2-[4-(2-fluoro-3-pyridinyl)-4-hydroxypiperidine-1-carbonyl]phenyl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110244989 |
| Molecular Formula | C22H22FN5O3 |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N-[2-[4-(2-fluoro-3-pyridinyl)-4-hydroxypiperidine-1-carbonyl]phenyl]-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)Nc2ccccc2C(=O)N2CCC(O)(c3cccnc3F)CC2)n1 |
| InChI | InChI=1S/C22H22FN5O3/c1-27-12-8-18(26-27)20(29)25-17-7-3-2-5-15(17)21(30)28-13-9-22(31,10-14-28)16-6-4-11-24-19(16)23/h2-8,11-12,31H,9-10,13-14H2,1H3,(H,25,29) |
| InChIKey | GXLAHPFSDOQSOF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|