C22H24FN3O4 — CID 95801017
7-[4-(2-fluoro-3-pyridinyl)-4-hydroxypiperidine-1-carbonyl]-2-(2-methoxyethyl)-3H-isoindol-1-one (PubChem CID 95801017) has the molecular formula C22H24FN3O4 and a molecular weight of 413.45 g/mol. Its IUPAC name is 7-[4-(2-fluoro-3-pyridinyl)-4-hydroxypiperidine-1-carbonyl]-2-(2-methoxyethyl)-3H-isoindol-1-one.
| Compound Name | 7-[4-(2-fluoro-3-pyridinyl)-4-hydroxypiperidine-1-carbonyl]-2-(2-methoxyethyl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 95801017 |
| Molecular Formula | C22H24FN3O4 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 7-[4-(2-fluoro-3-pyridinyl)-4-hydroxypiperidine-1-carbonyl]-2-(2-methoxyethyl)-3H-isoindol-1-one |
| SMILES | COCCN1Cc2cccc(C(=O)N3CCC(O)(c4cccnc4F)CC3)c2C1=O |
| InChI | InChI=1S/C22H24FN3O4/c1-30-13-12-26-14-15-4-2-5-16(18(15)21(26)28)20(27)25-10-7-22(29,8-11-25)17-6-3-9-24-19(17)23/h2-6,9,29H,7-8,10-14H2,1H3 |
| InChIKey | OQVVKXYMTMZIGU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|