C14H25NO2 — CID 110152921
N-[(2S,4R,4aS,7aR)-2-methyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]-3-methylbutanamide (PubChem CID 110152921) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is N-[(2S,4R,4aS,7aR)-2-methyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]-3-methylbutanamide.
| Compound Name | N-[(2S,4R,4aS,7aR)-2-methyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 110152921 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | N-[(2S,4R,4aS,7aR)-2-methyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)N[C@@H]1C[C@H](C)O[C@@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C14H25NO2/c1-9(2)7-14(16)15-12-8-10(3)17-13-6-4-5-11(12)13/h9-13H,4-8H2,1-3H3,(H,15,16)/t10-,11-,12+,13+/m0/s1 |
| InChIKey | RRTDPMFGCOFGEP-WUHRBBMRSA-N |
| XLogP | 2.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |