C17H32BNO4 — CID 174021890
N-(13-hydroxy-12,14-dioxa-13-borabicyclo[9.3.1]pentadecan-5-yl)-3-methylbutanamide (PubChem CID 174021890) has the molecular formula C17H32BNO4 and a molecular weight of 325.26 g/mol. Its IUPAC name is N-(13-hydroxy-12,14-dioxa-13-borabicyclo[9.3.1]pentadecan-5-yl)-3-methylbutanamide.
| Compound Name | N-(13-hydroxy-12,14-dioxa-13-borabicyclo[9.3.1]pentadecan-5-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 174021890 |
| Molecular Formula | C17H32BNO4 |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | N-(13-hydroxy-12,14-dioxa-13-borabicyclo[9.3.1]pentadecan-5-yl)-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC1CCCCCC2CC(CCC1)OB(O)O2 |
| InChI | InChI=1S/C17H32BNO4/c1-13(2)11-17(20)19-14-7-4-3-5-9-15-12-16(10-6-8-14)23-18(21)22-15/h13-16,21H,3-12H2,1-2H3,(H,19,20) |
| InChIKey | JRFFTUPQRQDSSL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|