C19H28N2O6 — CID 110153358
tert-butyl N-[(3R,4R,6R)-3,6-dihydroxy-1-(3-methoxybenzoyl)azepan-4-yl]carbamate (PubChem CID 110153358) has the molecular formula C19H28N2O6 and a molecular weight of 380.44 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R,6R)-3,6-dihydroxy-1-(3-methoxybenzoyl)azepan-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R,6R)-3,6-dihydroxy-1-(3-methoxybenzoyl)azepan-4-yl]carbamate |
|---|---|
| PubChem CID | 110153358 |
| Molecular Formula | C19H28N2O6 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | tert-butyl N-[(3R,4R,6R)-3,6-dihydroxy-1-(3-methoxybenzoyl)azepan-4-yl]carbamate |
| SMILES | COc1cccc(C(=O)N2C[C@H](O)C[C@@H](NC(=O)OC(C)(C)C)[C@H](O)C2)c1 |
| InChI | InChI=1S/C19H28N2O6/c1-19(2,3)27-18(25)20-15-9-13(22)10-21(11-16(15)23)17(24)12-6-5-7-14(8-12)26-4/h5-8,13,15-16,22-23H,9-11H2,1-4H3,(H,20,25)/t13-,15-,16-/m1/s1 |
| InChIKey | IBYQKTNGEUPNBE-FVQBIDKESA-N |
| XLogP | 1.16 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |