C23H29FN2O3 — CID 110154719
[(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-pentylpiperidin-1-yl]-(6-methyl-3-pyridinyl)methanone (PubChem CID 110154719) has the molecular formula C23H29FN2O3 and a molecular weight of 400.49 g/mol. Its IUPAC name is [(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-pentylpiperidin-1-yl]-(6-methyl-3-pyridinyl)methanone.
| Compound Name | [(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-pentylpiperidin-1-yl]-(6-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 110154719 |
| Molecular Formula | C23H29FN2O3 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [(3S,4S)-3-(3-fluorophenoxy)-4-hydroxy-4-pentylpiperidin-1-yl]-(6-methyl-3-pyridinyl)methanone |
| SMILES | CCCCC[C@]1(O)CCN(C(=O)c2ccc(C)nc2)C[C@@H]1Oc1cccc(F)c1 |
| InChI | InChI=1S/C23H29FN2O3/c1-3-4-5-11-23(28)12-13-26(22(27)18-10-9-17(2)25-15-18)16-21(23)29-20-8-6-7-19(24)14-20/h6-10,14-15,21,28H,3-5,11-13,16H2,1-2H3/t21-,23-/m0/s1 |
| InChIKey | JGERQPMMCFHJAW-GMAHTHKFSA-N |
| XLogP | 4.13 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|