C22H31NO8 — CID 110158140
N-[(2R,4R,4aS,7aR)-2-[4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]acetamide (PubChem CID 110158140) has the molecular formula C22H31NO8 and a molecular weight of 437.49 g/mol. Its IUPAC name is N-[(2R,4R,4aS,7aR)-2-[4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]acetamide.
| Compound Name | N-[(2R,4R,4aS,7aR)-2-[4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]acetamide |
|---|---|
| PubChem CID | 110158140 |
| Molecular Formula | C22H31NO8 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | N-[(2R,4R,4aS,7aR)-2-[4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-4-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C[C@H](c2ccc(O[C@H]3O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]3O)cc2)O[C@@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C22H31NO8/c1-11(25)23-15-9-17(30-16-4-2-3-14(15)16)12-5-7-13(8-6-12)29-22-21(28)20(27)19(26)18(10-24)31-22/h5-8,14-22,24,26-28H,2-4,9-10H2,1H3,(H,23,25)/t14-,15+,16+,17+,18-,19-,20+,21-,22-/m0/s1 |
| InChIKey | QKVTYHZJGINJIZ-RJLCQLISSA-N |
| XLogP | 0.00 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |