C18H17N3O2Se2 — CID 11016074
2-[2-[2-(3-oxo-1,2-benzoselenazol-2-yl)ethylamino]ethyl]-1,2-benzoselenazol-3-one (PubChem CID 11016074) has the molecular formula C18H17N3O2Se2 and a molecular weight of 465.27 g/mol. Its IUPAC name is 2-[2-[2-(3-oxo-1,2-benzoselenazol-2-yl)ethylamino]ethyl]-1,2-benzoselenazol-3-one.
| Compound Name | 2-[2-[2-(3-oxo-1,2-benzoselenazol-2-yl)ethylamino]ethyl]-1,2-benzoselenazol-3-one |
|---|---|
| PubChem CID | 11016074 |
| Molecular Formula | C18H17N3O2Se2 |
| Molecular Weight | 465.27 g/mol |
| Exact Mass | 466.97 |
| IUPAC Name | 2-[2-[2-(3-oxo-1,2-benzoselenazol-2-yl)ethylamino]ethyl]-1,2-benzoselenazol-3-one |
| SMILES | O=c1c2ccccc2[se]n1CCNCCn1[se]c2ccccc2c1=O |
| InChI | InChI=1S/C18H17N3O2Se2/c22-17-13-5-1-3-7-15(13)24-20(17)11-9-19-10-12-21-18(23)14-6-2-4-8-16(14)25-21/h1-8,19H,9-12H2 |
| InChIKey | RGMRTQRWRXBARJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|