C22H27ClN2O3 — CID 110161321
2-[2-(4-chlorophenyl)ethyl-[1-(3-methoxyphenyl)piperidin-4-yl]amino]acetic acid (PubChem CID 110161321) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)ethyl-[1-(3-methoxyphenyl)piperidin-4-yl]amino]acetic acid.
| Compound Name | 2-[2-(4-chlorophenyl)ethyl-[1-(3-methoxyphenyl)piperidin-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 110161321 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-[2-(4-chlorophenyl)ethyl-[1-(3-methoxyphenyl)piperidin-4-yl]amino]acetic acid |
| SMILES | COc1cccc(N2CCC(N(CCc3ccc(Cl)cc3)CC(=O)O)CC2)c1 |
| InChI | InChI=1S/C22H27ClN2O3/c1-28-21-4-2-3-20(15-21)24-13-10-19(11-14-24)25(16-22(26)27)12-9-17-5-7-18(23)8-6-17/h2-8,15,19H,9-14,16H2,1H3,(H,26,27) |
| InChIKey | MLWVHFCXWZVSFX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |