C22H27FN2O2 — CID 110161312
2-[2-(3-fluorophenyl)ethyl-[1-(4-methylphenyl)piperidin-4-yl]amino]acetic acid (PubChem CID 110161312) has the molecular formula C22H27FN2O2 and a molecular weight of 370.47 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)ethyl-[1-(4-methylphenyl)piperidin-4-yl]amino]acetic acid.
| Compound Name | 2-[2-(3-fluorophenyl)ethyl-[1-(4-methylphenyl)piperidin-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 110161312 |
| Molecular Formula | C22H27FN2O2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2-[2-(3-fluorophenyl)ethyl-[1-(4-methylphenyl)piperidin-4-yl]amino]acetic acid |
| SMILES | Cc1ccc(N2CCC(N(CCc3cccc(F)c3)CC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C22H27FN2O2/c1-17-5-7-20(8-6-17)24-13-10-21(11-14-24)25(16-22(26)27)12-9-18-3-2-4-19(23)15-18/h2-8,15,21H,9-14,16H2,1H3,(H,26,27) |
| InChIKey | FSCADWHYEDIATD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|