C20H20ClN3O3S2 — CID 110162762
4-chloro-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-piperidin-1-ylbenzamide (PubChem CID 110162762) has the molecular formula C20H20ClN3O3S2 and a molecular weight of 449.99 g/mol. Its IUPAC name is 4-chloro-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-piperidin-1-ylbenzamide.
| Compound Name | 4-chloro-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 110162762 |
| Molecular Formula | C20H20ClN3O3S2 |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 4-chloro-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-piperidin-1-ylbenzamide |
| SMILES | CS(=O)(=O)c1ccc2nc(NC(=O)c3ccc(Cl)c(N4CCCCC4)c3)sc2c1 |
| InChI | InChI=1S/C20H20ClN3O3S2/c1-29(26,27)14-6-8-16-18(12-14)28-20(22-16)23-19(25)13-5-7-15(21)17(11-13)24-9-3-2-4-10-24/h5-8,11-12H,2-4,9-10H2,1H3,(H,22,23,25) |
| InChIKey | ZGIIWXJZBOABHQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |