C16H19N3O4 — CID 110164098
N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-2-(4-oxoquinazolin-3-yl)acetamide (PubChem CID 110164098) has the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-2-(4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-2-(4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 110164098 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-2-(4-oxoquinazolin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2ccccc2c1=O)N[C@@H]1CCC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H19N3O4/c20-13-7-3-6-12(15(13)22)18-14(21)8-19-9-17-11-5-2-1-4-10(11)16(19)23/h1-2,4-5,9,12-13,15,20,22H,3,6-8H2,(H,18,21)/t12-,13-,15-/m1/s1 |
| InChIKey | SMFREDQYMXEDCD-UMVBOHGHSA-N |
| XLogP | -0.21 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |