C19H27NO4 — CID 110165070
N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-N-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetamide (PubChem CID 110165070) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-N-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-N-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetamide |
|---|---|
| PubChem CID | 110165070 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-N-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetamide |
| SMILES | CN(C(=O)COc1ccc2c(c1)CCCC2)[C@@H]1CCC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H27NO4/c1-20(16-7-4-8-17(21)19(16)23)18(22)12-24-15-10-9-13-5-2-3-6-14(13)11-15/h9-11,16-17,19,21,23H,2-8,12H2,1H3/t16-,17-,19-/m1/s1 |
| InChIKey | WEIJEYACNJCEOA-ZHALLVOQSA-N |
| XLogP | 1.68 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |