C18H25NO4 — CID 155996372
N-[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]-N-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide (PubChem CID 155996372) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is N-[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]-N-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide.
| Compound Name | N-[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]-N-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 155996372 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | N-[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]-N-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide |
| SMILES | CN(C(=O)Cc1ccc2c(c1)CCCC2)[C@@H]1COC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H25NO4/c1-19(15-10-23-11-16(20)18(15)22)17(21)9-12-6-7-13-4-2-3-5-14(13)8-12/h6-8,15-16,18,20,22H,2-5,9-11H2,1H3/t15-,16-,18+/m1/s1 |
| InChIKey | JGWATTUIALGQFO-NUJGCVRESA-N |
| XLogP | 0.69 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |