C24H20FN3O3 — CID 110165667
2-[(3-fluorophenyl)methyl-(2-methyl-1-phenylbenzimidazole-5-carbonyl)amino]acetic acid (PubChem CID 110165667) has the molecular formula C24H20FN3O3 and a molecular weight of 417.44 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl-(2-methyl-1-phenylbenzimidazole-5-carbonyl)amino]acetic acid.
| Compound Name | 2-[(3-fluorophenyl)methyl-(2-methyl-1-phenylbenzimidazole-5-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 110165667 |
| Molecular Formula | C24H20FN3O3 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl-(2-methyl-1-phenylbenzimidazole-5-carbonyl)amino]acetic acid |
| SMILES | Cc1nc2cc(C(=O)N(CC(=O)O)Cc3cccc(F)c3)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C24H20FN3O3/c1-16-26-21-13-18(10-11-22(21)28(16)20-8-3-2-4-9-20)24(31)27(15-23(29)30)14-17-6-5-7-19(25)12-17/h2-13H,14-15H2,1H3,(H,29,30) |
| InChIKey | UVCWBLMCTORJNW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |