C32H28N4O4 — CID 158432940
2-methyl-1-(3-methylphenyl)benzimidazole-5-carboxylic acid (PubChem CID 158432940) has the molecular formula C32H28N4O4 and a molecular weight of 532.60 g/mol. Its IUPAC name is 2-methyl-1-(3-methylphenyl)benzimidazole-5-carboxylic acid.
| Compound Name | 2-methyl-1-(3-methylphenyl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 158432940 |
| Molecular Formula | C32H28N4O4 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 2-methyl-1-(3-methylphenyl)benzimidazole-5-carboxylic acid |
| SMILES | Cc1cccc(-n2c(C)nc3cc(C(=O)O)ccc32)c1.Cc1cccc(-n2c(C)nc3cc(C(=O)O)ccc32)c1 |
| InChI | InChI=1S/2C16H14N2O2/c2*1-10-4-3-5-13(8-10)18-11(2)17-14-9-12(16(19)20)6-7-15(14)18/h2*3-9H,1-2H3,(H,19,20) |
| InChIKey | HBWMYFOYYSCMTI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |