C22H27N3O3 — CID 3655846
N-(2,2-diethoxyethyl)-2-methyl-1-(3-methylphenyl)benzimidazole-5-carboxamide (PubChem CID 3655846) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-2-methyl-1-(3-methylphenyl)benzimidazole-5-carboxamide.
| Compound Name | N-(2,2-diethoxyethyl)-2-methyl-1-(3-methylphenyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 3655846 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-(2,2-diethoxyethyl)-2-methyl-1-(3-methylphenyl)benzimidazole-5-carboxamide |
| SMILES | CCOC(CNC(=O)c1ccc2c(c1)nc(C)n2-c1cccc(C)c1)OCC |
| InChI | InChI=1S/C22H27N3O3/c1-5-27-21(28-6-2)14-23-22(26)17-10-11-20-19(13-17)24-16(4)25(20)18-9-7-8-15(3)12-18/h7-13,21H,5-6,14H2,1-4H3,(H,23,26) |
| InChIKey | MQSIOEPPIRIFRZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|