C25H24N2O4 — CID 110165717
2-[(4-methoxyphenyl)methyl-[2-(9-methylcarbazol-2-yl)acetyl]amino]acetic acid (PubChem CID 110165717) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl-[2-(9-methylcarbazol-2-yl)acetyl]amino]acetic acid.
| Compound Name | 2-[(4-methoxyphenyl)methyl-[2-(9-methylcarbazol-2-yl)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 110165717 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl-[2-(9-methylcarbazol-2-yl)acetyl]amino]acetic acid |
| SMILES | COc1ccc(CN(CC(=O)O)C(=O)Cc2ccc3c4ccccc4n(C)c3c2)cc1 |
| InChI | InChI=1S/C25H24N2O4/c1-26-22-6-4-3-5-20(22)21-12-9-18(13-23(21)26)14-24(28)27(16-25(29)30)15-17-7-10-19(31-2)11-8-17/h3-13H,14-16H2,1-2H3,(H,29,30) |
| InChIKey | OCLCOQAJLOYIRZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|