C23H25NO6 — CID 70347362
2-[[2-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]acetyl]-[(4-methoxyphenyl)methyl]amino]acetic acid (PubChem CID 70347362) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is 2-[[2-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]acetyl]-[(4-methoxyphenyl)methyl]amino]acetic acid.
| Compound Name | 2-[[2-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]acetyl]-[(4-methoxyphenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 70347362 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-[[2-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]acetyl]-[(4-methoxyphenyl)methyl]amino]acetic acid |
| SMILES | CCOC(=O)/C=C/c1ccc(CC(=O)N(CC(=O)O)Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H25NO6/c1-3-30-23(28)13-10-17-4-6-18(7-5-17)14-21(25)24(16-22(26)27)15-19-8-11-20(29-2)12-9-19/h4-13H,3,14-16H2,1-2H3,(H,26,27)/b13-10+ |
| InChIKey | KDRFXVLRIYTLNR-JLHYYAGUSA-N |
| XLogP | 2.93 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|