C21H17ClFNO4S — CID 110165961
N-(3-chloro-2-methylphenyl)sulfonyl-3-fluoro-2-(4-methylphenoxy)benzamide (PubChem CID 110165961) has the molecular formula C21H17ClFNO4S and a molecular weight of 433.89 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)sulfonyl-3-fluoro-2-(4-methylphenoxy)benzamide.
| Compound Name | N-(3-chloro-2-methylphenyl)sulfonyl-3-fluoro-2-(4-methylphenoxy)benzamide |
|---|---|
| PubChem CID | 110165961 |
| Molecular Formula | C21H17ClFNO4S |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)sulfonyl-3-fluoro-2-(4-methylphenoxy)benzamide |
| SMILES | Cc1ccc(Oc2c(F)cccc2C(=O)NS(=O)(=O)c2cccc(Cl)c2C)cc1 |
| InChI | InChI=1S/C21H17ClFNO4S/c1-13-9-11-15(12-10-13)28-20-16(5-3-7-18(20)23)21(25)24-29(26,27)19-8-4-6-17(22)14(19)2/h3-12H,1-2H3,(H,24,25) |
| InChIKey | MFEJBJMETUSUCT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |