C21H22FNO5 — CID 110166476
2-[2-[(2R,4S,6S)-4-acetamido-6-phenyloxan-2-yl]-5-fluorophenoxy]acetic acid (PubChem CID 110166476) has the molecular formula C21H22FNO5 and a molecular weight of 387.41 g/mol. Its IUPAC name is 2-[2-[(2R,4S,6S)-4-acetamido-6-phenyloxan-2-yl]-5-fluorophenoxy]acetic acid.
| Compound Name | 2-[2-[(2R,4S,6S)-4-acetamido-6-phenyloxan-2-yl]-5-fluorophenoxy]acetic acid |
|---|---|
| PubChem CID | 110166476 |
| Molecular Formula | C21H22FNO5 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 2-[2-[(2R,4S,6S)-4-acetamido-6-phenyloxan-2-yl]-5-fluorophenoxy]acetic acid |
| SMILES | CC(=O)N[C@H]1C[C@@H](c2ccccc2)O[C@@H](c2ccc(F)cc2OCC(=O)O)C1 |
| InChI | InChI=1S/C21H22FNO5/c1-13(24)23-16-10-18(14-5-3-2-4-6-14)28-20(11-16)17-8-7-15(22)9-19(17)27-12-21(25)26/h2-9,16,18,20H,10-12H2,1H3,(H,23,24)(H,25,26)/t16-,18-,20+/m0/s1 |
| InChIKey | NXIJHSRVZKMRKB-XKGZKEIXSA-N |
| XLogP | 3.39 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |