C16H26N2O — CID 110168185
2-ethyl-N'-(2-methyl-1-phenylpropan-2-yl)butanehydrazide (PubChem CID 110168185) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 2-ethyl-N'-(2-methyl-1-phenylpropan-2-yl)butanehydrazide.
| Compound Name | 2-ethyl-N'-(2-methyl-1-phenylpropan-2-yl)butanehydrazide |
|---|---|
| PubChem CID | 110168185 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 2-ethyl-N'-(2-methyl-1-phenylpropan-2-yl)butanehydrazide |
| SMILES | CCC(CC)C(=O)NNC(C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C16H26N2O/c1-5-14(6-2)15(19)17-18-16(3,4)12-13-10-8-7-9-11-13/h7-11,14,18H,5-6,12H2,1-4H3,(H,17,19) |
| InChIKey | OMBKHIZKYIVKOZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|