C23H33N3O6 — CID 110169015
1-amino-3-[3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propyl-methylamino]propan-2-ol;oxalic acid;hydrate (PubChem CID 110169015) has the molecular formula C23H33N3O6 and a molecular weight of 447.53 g/mol. Its IUPAC name is 1-amino-3-[3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propyl-methylamino]propan-2-ol;oxalic acid;hydrate.
| Compound Name | 1-amino-3-[3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propyl-methylamino]propan-2-ol;oxalic acid;hydrate |
|---|---|
| PubChem CID | 110169015 |
| Molecular Formula | C23H33N3O6 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 1-amino-3-[3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propyl-methylamino]propan-2-ol;oxalic acid;hydrate |
| SMILES | CN(CCCN1c2ccccc2CCc2ccccc21)CC(O)CN.O.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H29N3O.C2H2O4.H2O/c1-23(16-19(25)15-22)13-6-14-24-20-9-4-2-7-17(20)11-12-18-8-3-5-10-21(18)24;3-1(4)2(5)6;/h2-5,7-10,19,25H,6,11-16,22H2,1H3;(H,3,4)(H,5,6);1H2 |
| InChIKey | BRHQIQQUIVTPGE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 158.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|