C15H14N2O4S — CID 110169571
5-methoxy-1-(4-methylphenyl)sulfonyl-2H-indazol-3-one (PubChem CID 110169571) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is 5-methoxy-1-(4-methylphenyl)sulfonyl-2H-indazol-3-one.
| Compound Name | 5-methoxy-1-(4-methylphenyl)sulfonyl-2H-indazol-3-one |
|---|---|
| PubChem CID | 110169571 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 5-methoxy-1-(4-methylphenyl)sulfonyl-2H-indazol-3-one |
| SMILES | COc1ccc2c(c1)c(=O)[nH]n2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H14N2O4S/c1-10-3-6-12(7-4-10)22(19,20)17-14-8-5-11(21-2)9-13(14)15(18)16-17/h3-9H,1-2H3,(H,16,18) |
| InChIKey | JFEASNWIAMDZKS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |