C20H21NO3S — CID 71722470
5-methoxy-2-methyl-1-(4-methylphenyl)sulfonyl-3-prop-2-enylindole (PubChem CID 71722470) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is 5-methoxy-2-methyl-1-(4-methylphenyl)sulfonyl-3-prop-2-enylindole.
| Compound Name | 5-methoxy-2-methyl-1-(4-methylphenyl)sulfonyl-3-prop-2-enylindole |
|---|---|
| PubChem CID | 71722470 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 5-methoxy-2-methyl-1-(4-methylphenyl)sulfonyl-3-prop-2-enylindole |
| SMILES | C=CCc1c(C)n(S(=O)(=O)c2ccc(C)cc2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C20H21NO3S/c1-5-6-18-15(3)21(20-12-9-16(24-4)13-19(18)20)25(22,23)17-10-7-14(2)8-11-17/h5,7-13H,1,6H2,2-4H3 |
| InChIKey | JNGLSBWBBXFQQW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|