C24H25NO6S — CID 132938612
methyl (11S,15R)-15-hydroxy-4-methoxy-8-(4-methylphenyl)sulfonyl-8-azatetracyclo[7.6.0.02,7.011,15]pentadeca-1(9),2(7),3,5-tetraene-11-carboxylate (PubChem CID 132938612) has the molecular formula C24H25NO6S and a molecular weight of 455.53 g/mol. Its IUPAC name is methyl (11S,15R)-15-hydroxy-4-methoxy-8-(4-methylphenyl)sulfonyl-8-azatetracyclo[7.6.0.02,7.011,15]pentadeca-1(9),2(7),3,5-tetraene-11-carboxylate.
| Compound Name | methyl (11S,15R)-15-hydroxy-4-methoxy-8-(4-methylphenyl)sulfonyl-8-azatetracyclo[7.6.0.02,7.011,15]pentadeca-1(9),2(7),3,5-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 132938612 |
| Molecular Formula | C24H25NO6S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | methyl (11S,15R)-15-hydroxy-4-methoxy-8-(4-methylphenyl)sulfonyl-8-azatetracyclo[7.6.0.02,7.011,15]pentadeca-1(9),2(7),3,5-tetraene-11-carboxylate |
| SMILES | COC(=O)[C@]12CCC[C@@]1(O)c1c(n(S(=O)(=O)c3ccc(C)cc3)c3ccc(OC)cc13)C2 |
| InChI | InChI=1S/C24H25NO6S/c1-15-5-8-17(9-6-15)32(28,29)25-19-10-7-16(30-2)13-18(19)21-20(25)14-23(22(26)31-3)11-4-12-24(21,23)27/h5-10,13,27H,4,11-12,14H2,1-3H3/t23-,24-/m1/s1 |
| InChIKey | BKPJOZIUZXMLJM-DNQXCXABSA-N |
| XLogP | 3.28 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |