C24H30N2O4S2 — CID 175117828
tert-butyl-[[(4R)-6-methoxy-9-(4-methylphenyl)sulfonyl-1,2,3,4-tetrahydrocarbazol-4-yl]amino]-oxidosulfanium (PubChem CID 175117828) has the molecular formula C24H30N2O4S2 and a molecular weight of 474.65 g/mol. Its IUPAC name is tert-butyl-[[(4R)-6-methoxy-9-(4-methylphenyl)sulfonyl-1,2,3,4-tetrahydrocarbazol-4-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(4R)-6-methoxy-9-(4-methylphenyl)sulfonyl-1,2,3,4-tetrahydrocarbazol-4-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175117828 |
| Molecular Formula | C24H30N2O4S2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | tert-butyl-[[(4R)-6-methoxy-9-(4-methylphenyl)sulfonyl-1,2,3,4-tetrahydrocarbazol-4-yl]amino]-oxidosulfanium |
| SMILES | COc1ccc2c(c1)c1c(n2S(=O)(=O)c2ccc(C)cc2)CCC[C@H]1N[S+]([O-])C(C)(C)C |
| InChI | InChI=1S/C24H30N2O4S2/c1-16-9-12-18(13-10-16)32(28,29)26-21-14-11-17(30-5)15-19(21)23-20(7-6-8-22(23)26)25-31(27)24(2,3)4/h9-15,20,25H,6-8H2,1-5H3/t20-,31?/m1/s1 |
| InChIKey | FBZAZVVNTPLSLY-DXHYANOHSA-N |
| XLogP | 4.62 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|