C16H21ClN2O3S2 — CID 175121562
tert-butyl-[[(4S)-9-chlorosulfonyl-1,2,3,4-tetrahydrocarbazol-4-yl]amino]-oxidosulfanium (PubChem CID 175121562) has the molecular formula C16H21ClN2O3S2 and a molecular weight of 388.94 g/mol. Its IUPAC name is tert-butyl-[[(4S)-9-chlorosulfonyl-1,2,3,4-tetrahydrocarbazol-4-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(4S)-9-chlorosulfonyl-1,2,3,4-tetrahydrocarbazol-4-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175121562 |
| Molecular Formula | C16H21ClN2O3S2 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | tert-butyl-[[(4S)-9-chlorosulfonyl-1,2,3,4-tetrahydrocarbazol-4-yl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@H]1CCCc2c1c1ccccc1n2S(=O)(=O)Cl |
| InChI | InChI=1S/C16H21ClN2O3S2/c1-16(2,3)23(20)18-12-8-6-10-14-15(12)11-7-4-5-9-13(11)19(14)24(17,21)22/h4-5,7,9,12,18H,6,8,10H2,1-3H3/t12-,23?/m0/s1 |
| InChIKey | FWVCPHIALSXDOM-AKYMPMEGSA-N |
| XLogP | 3.40 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|