C17H13Cl3N4O2 — CID 110169955
2-[1-(3-chloropropyl)pyrrolo[2,3-b]pyridin-3-yl]-N-(3,5-dichloro-4-pyridinyl)-2-oxoacetamide (PubChem CID 110169955) has the molecular formula C17H13Cl3N4O2 and a molecular weight of 411.68 g/mol. Its IUPAC name is 2-[1-(3-chloropropyl)pyrrolo[2,3-b]pyridin-3-yl]-N-(3,5-dichloro-4-pyridinyl)-2-oxoacetamide.
| Compound Name | 2-[1-(3-chloropropyl)pyrrolo[2,3-b]pyridin-3-yl]-N-(3,5-dichloro-4-pyridinyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 110169955 |
| Molecular Formula | C17H13Cl3N4O2 |
| Molecular Weight | 411.68 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | 2-[1-(3-chloropropyl)pyrrolo[2,3-b]pyridin-3-yl]-N-(3,5-dichloro-4-pyridinyl)-2-oxoacetamide |
| SMILES | O=C(Nc1c(Cl)cncc1Cl)C(=O)c1cn(CCCCl)c2ncccc12 |
| InChI | InChI=1S/C17H13Cl3N4O2/c18-4-2-6-24-9-11(10-3-1-5-22-16(10)24)15(25)17(26)23-14-12(19)7-21-8-13(14)20/h1,3,5,7-9H,2,4,6H2,(H,21,23,26) |
| InChIKey | YRFLRQVNHQUSJJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.68 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|