C21H13Cl2FN4O2 — CID 110170775
N-(3,5-dichloro-4-pyridinyl)-2-oxo-2-[1-[(2,3,5,6-tetradeuterio-4-fluorophenyl)methyl]pyrrolo[2,3-b]pyridin-3-yl]acetamide (PubChem CID 110170775) has the molecular formula C21H13Cl2FN4O2 and a molecular weight of 447.29 g/mol. Its IUPAC name is N-(3,5-dichloro-4-pyridinyl)-2-oxo-2-[1-[(2,3,5,6-tetradeuterio-4-fluorophenyl)methyl]pyrrolo[2,3-b]pyridin-3-yl]acetamide.
| Compound Name | N-(3,5-dichloro-4-pyridinyl)-2-oxo-2-[1-[(2,3,5,6-tetradeuterio-4-fluorophenyl)methyl]pyrrolo[2,3-b]pyridin-3-yl]acetamide |
|---|---|
| PubChem CID | 110170775 |
| Molecular Formula | C21H13Cl2FN4O2 |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | N-(3,5-dichloro-4-pyridinyl)-2-oxo-2-[1-[(2,3,5,6-tetradeuterio-4-fluorophenyl)methyl]pyrrolo[2,3-b]pyridin-3-yl]acetamide |
| SMILES | [2H]c1c([2H])c(Cn2cc(C(=O)C(=O)Nc3c(Cl)cncc3Cl)c3cccnc32)c([2H])c([2H])c1F |
| InChI | InChI=1S/C21H13Cl2FN4O2/c22-16-8-25-9-17(23)18(16)27-21(30)19(29)15-11-28(20-14(15)2-1-7-26-20)10-12-3-5-13(24)6-4-12/h1-9,11H,10H2,(H,25,27,30)/i3D,4D,5D,6D |
| InChIKey | JERXUPDBWDWFCF-LNFUJOGGSA-N |
| XLogP | 4.75 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|