C18H12FN5O2 — CID 10154815
1-[1-[(4-fluorophenyl)methyl]pyrrolo[2,3-b]pyridin-3-yl]-2-(1H-1,2,4-triazol-5-yl)ethane-1,2-dione (PubChem CID 10154815) has the molecular formula C18H12FN5O2 and a molecular weight of 349.33 g/mol. Its IUPAC name is 1-[1-[(4-fluorophenyl)methyl]pyrrolo[2,3-b]pyridin-3-yl]-2-(1H-1,2,4-triazol-5-yl)ethane-1,2-dione.
| Compound Name | 1-[1-[(4-fluorophenyl)methyl]pyrrolo[2,3-b]pyridin-3-yl]-2-(1H-1,2,4-triazol-5-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 10154815 |
| Molecular Formula | C18H12FN5O2 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 1-[1-[(4-fluorophenyl)methyl]pyrrolo[2,3-b]pyridin-3-yl]-2-(1H-1,2,4-triazol-5-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)c1cn(Cc2ccc(F)cc2)c2ncccc12)c1ncn[nH]1 |
| InChI | InChI=1S/C18H12FN5O2/c19-12-5-3-11(4-6-12)8-24-9-14(13-2-1-7-20-18(13)24)15(25)16(26)17-21-10-22-23-17/h1-7,9-10H,8H2,(H,21,22,23) |
| InChIKey | PXHRGKQLIMPARV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|