C22H25ClFN3 — CID 110170320
4-benzyl-1-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]piperidine;hydrochloride (PubChem CID 110170320) has the molecular formula C22H25ClFN3 and a molecular weight of 385.91 g/mol. Its IUPAC name is 4-benzyl-1-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]piperidine;hydrochloride.
| Compound Name | 4-benzyl-1-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 110170320 |
| Molecular Formula | C22H25ClFN3 |
| Molecular Weight | 385.91 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 4-benzyl-1-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]piperidine;hydrochloride |
| SMILES | Cl.Fc1cccc(-n2cc(CN3CCC(Cc4ccccc4)CC3)cn2)c1 |
| InChI | InChI=1S/C22H24FN3.ClH/c23-21-7-4-8-22(14-21)26-17-20(15-24-26)16-25-11-9-19(10-12-25)13-18-5-2-1-3-6-18;/h1-8,14-15,17,19H,9-13,16H2;1H |
| InChIKey | DXRHSAQYFLTXHJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.91 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |