C17H20FN3O — CID 138806025
(3aS,6aR)-2-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol (PubChem CID 138806025) has the molecular formula C17H20FN3O and a molecular weight of 301.37 g/mol. Its IUPAC name is (3aS,6aR)-2-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol.
| Compound Name | (3aS,6aR)-2-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol |
|---|---|
| PubChem CID | 138806025 |
| Molecular Formula | C17H20FN3O |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | (3aS,6aR)-2-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol |
| SMILES | OC1C[C@@H]2CN(Cc3cnn(-c4cccc(F)c4)c3)C[C@@H]2C1 |
| InChI | InChI=1S/C17H20FN3O/c18-15-2-1-3-16(6-15)21-9-12(7-19-21)8-20-10-13-4-17(22)5-14(13)11-20/h1-3,6-7,9,13-14,17,22H,4-5,8,10-11H2/t13-,14+,17? |
| InChIKey | MTOXTYRCWOQUJD-VMZNBEPHSA-N |
| XLogP | 2.21 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |