C26H22ClFN4O4 — CID 110172661
1-[(2-chloro-4-fluorophenyl)methyl]-N-(4-morpholin-4-ylphenyl)-4,6-dioxo-5H-1,5-naphthyridine-3-carboxamide (PubChem CID 110172661) has the molecular formula C26H22ClFN4O4 and a molecular weight of 508.94 g/mol. Its IUPAC name is 1-[(2-chloro-4-fluorophenyl)methyl]-N-(4-morpholin-4-ylphenyl)-4,6-dioxo-5H-1,5-naphthyridine-3-carboxamide.
| Compound Name | 1-[(2-chloro-4-fluorophenyl)methyl]-N-(4-morpholin-4-ylphenyl)-4,6-dioxo-5H-1,5-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 110172661 |
| Molecular Formula | C26H22ClFN4O4 |
| Molecular Weight | 508.94 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 1-[(2-chloro-4-fluorophenyl)methyl]-N-(4-morpholin-4-ylphenyl)-4,6-dioxo-5H-1,5-naphthyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)c1cn(Cc2ccc(F)cc2Cl)c2ccc(=O)[nH]c2c1=O |
| InChI | InChI=1S/C26H22ClFN4O4/c27-21-13-17(28)2-1-16(21)14-32-15-20(25(34)24-22(32)7-8-23(33)30-24)26(35)29-18-3-5-19(6-4-18)31-9-11-36-12-10-31/h1-8,13,15H,9-12,14H2,(H,29,35)(H,30,33) |
| InChIKey | AODGHHWEDRULBR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.94 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|