C33H56O6Si — CID 11017280
2-[(2S,4S,5R,6S)-2-(4-methoxyphenyl)-6-[(E)-1-[(1R,3R,4R)-3-methoxy-4-tri(propan-2-yl)silyloxycyclohexyl]prop-1-en-2-yl]-5-methyl-1,3-dioxan-4-yl]ethanol (PubChem CID 11017280) has the molecular formula C33H56O6Si and a molecular weight of 576.89 g/mol. Its IUPAC name is 2-[(2S,4S,5R,6S)-2-(4-methoxyphenyl)-6-[(E)-1-[(1R,3R,4R)-3-methoxy-4-tri(propan-2-yl)silyloxycyclohexyl]prop-1-en-2-yl]-5-methyl-1,3-dioxan-4-yl]ethanol.
| Compound Name | 2-[(2S,4S,5R,6S)-2-(4-methoxyphenyl)-6-[(E)-1-[(1R,3R,4R)-3-methoxy-4-tri(propan-2-yl)silyloxycyclohexyl]prop-1-en-2-yl]-5-methyl-1,3-dioxan-4-yl]ethanol |
|---|---|
| PubChem CID | 11017280 |
| Molecular Formula | C33H56O6Si |
| Molecular Weight | 576.89 g/mol |
| Exact Mass | 576.38 |
| IUPAC Name | 2-[(2S,4S,5R,6S)-2-(4-methoxyphenyl)-6-[(E)-1-[(1R,3R,4R)-3-methoxy-4-tri(propan-2-yl)silyloxycyclohexyl]prop-1-en-2-yl]-5-methyl-1,3-dioxan-4-yl]ethanol |
| SMILES | COc1ccc([C@H]2O[C@@H](CCO)[C@@H](C)[C@@H](/C(C)=C/[C@@H]3CC[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](OC)C3)O2)cc1 |
| InChI | InChI=1S/C33H56O6Si/c1-21(2)40(22(3)4,23(5)6)39-30-16-11-26(20-31(30)36-10)19-24(7)32-25(8)29(17-18-34)37-33(38-32)27-12-14-28(35-9)15-13-27/h12-15,19,21-23,25-26,29-34H,11,16-18,20H2,1-10H3/b24-19+/t25-,26+,29+,30-,31-,32-,33+/m1/s1 |
| InChIKey | IAPGQJPZYZUORD-YIAVYZLKSA-N |
| XLogP | 7.82 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.89 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|