C17H9Cl2NO3S — CID 110172928
4,5-dichloro-2-(5-pyridin-2-ylthiophene-2-carbonyl)benzoic acid (PubChem CID 110172928) has the molecular formula C17H9Cl2NO3S and a molecular weight of 378.24 g/mol. Its IUPAC name is 4,5-dichloro-2-(5-pyridin-2-ylthiophene-2-carbonyl)benzoic acid.
| Compound Name | 4,5-dichloro-2-(5-pyridin-2-ylthiophene-2-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 110172928 |
| Molecular Formula | C17H9Cl2NO3S |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 376.97 |
| IUPAC Name | 4,5-dichloro-2-(5-pyridin-2-ylthiophene-2-carbonyl)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(Cl)cc1C(=O)c1ccc(-c2ccccn2)s1 |
| InChI | InChI=1S/C17H9Cl2NO3S/c18-11-7-9(10(17(22)23)8-12(11)19)16(21)15-5-4-14(24-15)13-3-1-2-6-20-13/h1-8H,(H,22,23) |
| InChIKey | QOCBLNXNYBILDM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |