C29H33N5O6S — CID 11017302
ethyl (2S)-4-methyl-2-[[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]phenyl]sulfonyl-[(4-nitrophenyl)methyl]amino]pentanoate (PubChem CID 11017302) has the molecular formula C29H33N5O6S and a molecular weight of 579.68 g/mol. Its IUPAC name is ethyl (2S)-4-methyl-2-[[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]phenyl]sulfonyl-[(4-nitrophenyl)methyl]amino]pentanoate.
| Compound Name | ethyl (2S)-4-methyl-2-[[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]phenyl]sulfonyl-[(4-nitrophenyl)methyl]amino]pentanoate |
|---|---|
| PubChem CID | 11017302 |
| Molecular Formula | C29H33N5O6S |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | ethyl (2S)-4-methyl-2-[[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]phenyl]sulfonyl-[(4-nitrophenyl)methyl]amino]pentanoate |
| SMILES | CCOC(=O)[C@H](CC(C)C)N(Cc1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccc(Cn2c(C)nc3cnccc32)cc1 |
| InChI | InChI=1S/C29H33N5O6S/c1-5-40-29(35)28(16-20(2)3)33(19-23-6-10-24(11-7-23)34(36)37)41(38,39)25-12-8-22(9-13-25)18-32-21(4)31-26-17-30-15-14-27(26)32/h6-15,17,20,28H,5,16,18-19H2,1-4H3/t28-/m0/s1 |
| InChIKey | KDXSGJKFKQLSSC-NDEPHWFRSA-N |
| XLogP | 4.86 |
| TPSA | 137.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|