C27H32N6O3S — CID 10907446
(2S)-N-[(4-aminophenyl)methyl]-4-methyl-2-[[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]phenyl]sulfonylamino]pentanamide (PubChem CID 10907446) has the molecular formula C27H32N6O3S and a molecular weight of 520.66 g/mol. Its IUPAC name is (2S)-N-[(4-aminophenyl)methyl]-4-methyl-2-[[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]phenyl]sulfonylamino]pentanamide.
| Compound Name | (2S)-N-[(4-aminophenyl)methyl]-4-methyl-2-[[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]phenyl]sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 10907446 |
| Molecular Formula | C27H32N6O3S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | (2S)-N-[(4-aminophenyl)methyl]-4-methyl-2-[[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]phenyl]sulfonylamino]pentanamide |
| SMILES | Cc1nc2cnccc2n1Cc1ccc(S(=O)(=O)N[C@@H](CC(C)C)C(=O)NCc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C27H32N6O3S/c1-18(2)14-24(27(34)30-15-20-4-8-22(28)9-5-20)32-37(35,36)23-10-6-21(7-11-23)17-33-19(3)31-25-16-29-13-12-26(25)33/h4-13,16,18,24,32H,14-15,17,28H2,1-3H3,(H,30,34)/t24-/m0/s1 |
| InChIKey | ADISYWHBTGIIJN-DEOSSOPVSA-N |
| XLogP | 3.38 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|