C23H30N4O3S — CID 67625068
4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]-N-[(2S)-4-methyl-1-prop-2-enoxypentan-2-yl]benzenesulfonamide (PubChem CID 67625068) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]-N-[(2S)-4-methyl-1-prop-2-enoxypentan-2-yl]benzenesulfonamide.
| Compound Name | 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]-N-[(2S)-4-methyl-1-prop-2-enoxypentan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67625068 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]-N-[(2S)-4-methyl-1-prop-2-enoxypentan-2-yl]benzenesulfonamide |
| SMILES | C=CCOC[C@H](CC(C)C)NS(=O)(=O)c1ccc(Cn2c(C)nc3cnccc32)cc1 |
| InChI | InChI=1S/C23H30N4O3S/c1-5-12-30-16-20(13-17(2)3)26-31(28,29)21-8-6-19(7-9-21)15-27-18(4)25-22-14-24-11-10-23(22)27/h5-11,14,17,20,26H,1,12-13,15-16H2,2-4H3/t20-/m0/s1 |
| InChIKey | ZRZXONLFMVWOAE-FQEVSTJZSA-N |
| XLogP | 3.68 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|