C21H26N4O3S — CID 19800892
N-(1-ethoxypent-4-en-2-yl)-4-[(2-methylimidazo[4,5-c]pyridin-3-yl)methyl]benzenesulfonamide (PubChem CID 19800892) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is N-(1-ethoxypent-4-en-2-yl)-4-[(2-methylimidazo[4,5-c]pyridin-3-yl)methyl]benzenesulfonamide.
| Compound Name | N-(1-ethoxypent-4-en-2-yl)-4-[(2-methylimidazo[4,5-c]pyridin-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19800892 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-(1-ethoxypent-4-en-2-yl)-4-[(2-methylimidazo[4,5-c]pyridin-3-yl)methyl]benzenesulfonamide |
| SMILES | C=CCC(COCC)NS(=O)(=O)c1ccc(Cn2c(C)nc3ccncc32)cc1 |
| InChI | InChI=1S/C21H26N4O3S/c1-4-6-18(15-28-5-2)24-29(26,27)19-9-7-17(8-10-19)14-25-16(3)23-20-11-12-22-13-21(20)25/h4,7-13,18,24H,1,5-6,14-15H2,2-3H3 |
| InChIKey | IEWFPFZOXGSCRO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|