C23H32N4O3S — CID 67624609
4-[(2-methyl-2,3-dihydroimidazo[4,5-c]pyridin-1-yl)methyl]-N-[(2R)-4-methyl-1-prop-2-enoxypentan-2-yl]benzenesulfonamide (PubChem CID 67624609) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is 4-[(2-methyl-2,3-dihydroimidazo[4,5-c]pyridin-1-yl)methyl]-N-[(2R)-4-methyl-1-prop-2-enoxypentan-2-yl]benzenesulfonamide.
| Compound Name | 4-[(2-methyl-2,3-dihydroimidazo[4,5-c]pyridin-1-yl)methyl]-N-[(2R)-4-methyl-1-prop-2-enoxypentan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67624609 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 4-[(2-methyl-2,3-dihydroimidazo[4,5-c]pyridin-1-yl)methyl]-N-[(2R)-4-methyl-1-prop-2-enoxypentan-2-yl]benzenesulfonamide |
| SMILES | C=CCOC[C@@H](CC(C)C)NS(=O)(=O)c1ccc(CN2c3ccncc3NC2C)cc1 |
| InChI | InChI=1S/C23H32N4O3S/c1-5-12-30-16-20(13-17(2)3)26-31(28,29)21-8-6-19(7-9-21)15-27-18(4)25-22-14-24-11-10-23(22)27/h5-11,14,17-18,20,25-26H,1,12-13,15-16H2,2-4H3/t18?,20-/m1/s1 |
| InChIKey | JJARFIHHYFWJAP-ROPPNANJSA-N |
| XLogP | 3.76 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|