C31H36Cl2N6O2 — CID 110173171
8-[3-(4-benzhydrylpiperazine-1,4-diium-1-yl)propyl]-12-methoxy-3-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one dichloride (PubChem CID 110173171) has the molecular formula C31H36Cl2N6O2 and a molecular weight of 595.58 g/mol. Its IUPAC name is 8-[3-(4-benzhydrylpiperazine-1,4-diium-1-yl)propyl]-12-methoxy-3-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one dichloride.
| Compound Name | 8-[3-(4-benzhydrylpiperazine-1,4-diium-1-yl)propyl]-12-methoxy-3-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one dichloride |
|---|---|
| PubChem CID | 110173171 |
| Molecular Formula | C31H36Cl2N6O2 |
| Molecular Weight | 595.58 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | 8-[3-(4-benzhydrylpiperazine-1,4-diium-1-yl)propyl]-12-methoxy-3-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one dichloride |
| SMILES | COc1ccc2c(n1)n1c(C)ncc1c(=O)n2CCC[NH+]1CC[NH+](C(c2ccccc2)c2ccccc2)CC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C31H34N6O2.2ClH/c1-23-32-22-27-31(38)36(26-14-15-28(39-2)33-30(26)37(23)27)17-9-16-34-18-20-35(21-19-34)29(24-10-5-3-6-11-24)25-12-7-4-8-13-25;;/h3-8,10-15,22,29H,9,16-21H2,1-2H3;2*1H |
| InChIKey | NGFZSRXOBJDKES-UHFFFAOYSA-N |
| XLogP | -4.67 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.58 |
| LogP ≤ 5 | -4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |