C25H30ClN5O2 — CID 110188131
12-methoxy-8-[3-[4-(4-methylphenyl)piperazin-1-ium-1-yl]propyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one chloride (PubChem CID 110188131) has the molecular formula C25H30ClN5O2 and a molecular weight of 468.00 g/mol. Its IUPAC name is 12-methoxy-8-[3-[4-(4-methylphenyl)piperazin-1-ium-1-yl]propyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one chloride.
| Compound Name | 12-methoxy-8-[3-[4-(4-methylphenyl)piperazin-1-ium-1-yl]propyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one chloride |
|---|---|
| PubChem CID | 110188131 |
| Molecular Formula | C25H30ClN5O2 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 12-methoxy-8-[3-[4-(4-methylphenyl)piperazin-1-ium-1-yl]propyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one chloride |
| SMILES | COc1ccc2c(n1)n1cccc1c(=O)n2CCC[NH+]1CCN(c2ccc(C)cc2)CC1.[Cl-] |
| InChI | InChI=1S/C25H29N5O2.ClH/c1-19-6-8-20(9-7-19)28-17-15-27(16-18-28)12-4-14-30-21-10-11-23(32-2)26-24(21)29-13-3-5-22(29)25(30)31;/h3,5-11,13H,4,12,14-18H2,1-2H3;1H |
| InChIKey | FEANWFIJMUIWAW-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|