C14H15N3O2 — CID 110188611
12-ethoxy-8-ethyl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one (PubChem CID 110188611) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 12-ethoxy-8-ethyl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one.
| Compound Name | 12-ethoxy-8-ethyl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one |
|---|---|
| PubChem CID | 110188611 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 12-ethoxy-8-ethyl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one |
| SMILES | CCOc1ccc2c(n1)n1cccc1c(=O)n2CC |
| InChI | InChI=1S/C14H15N3O2/c1-3-16-10-7-8-12(19-4-2)15-13(10)17-9-5-6-11(17)14(16)18/h5-9H,3-4H2,1-2H3 |
| InChIKey | ASXYMYXQFLQEDR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |