C13H15N5O — CID 110173626
12-methoxy-3-propan-2-yl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine (PubChem CID 110173626) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is 12-methoxy-3-propan-2-yl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine.
| Compound Name | 12-methoxy-3-propan-2-yl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine |
|---|---|
| PubChem CID | 110173626 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 12-methoxy-3-propan-2-yl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine |
| SMILES | COc1ccc2nc(N)c3cnc(C(C)C)n3c2n1 |
| InChI | InChI=1S/C13H15N5O/c1-7(2)12-15-6-9-11(14)16-8-4-5-10(19-3)17-13(8)18(9)12/h4-7H,1-3H3,(H2,14,16) |
| InChIKey | OTLXOEBPVIUECP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |