C13H18ClN3O3S — CID 115322892
2-(1-chloroethyl)-5-methoxy-3-(3-methylsulfonylpropyl)imidazo[4,5-b]pyridine (PubChem CID 115322892) has the molecular formula C13H18ClN3O3S and a molecular weight of 331.83 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-methoxy-3-(3-methylsulfonylpropyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(1-chloroethyl)-5-methoxy-3-(3-methylsulfonylpropyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 115322892 |
| Molecular Formula | C13H18ClN3O3S |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-(1-chloroethyl)-5-methoxy-3-(3-methylsulfonylpropyl)imidazo[4,5-b]pyridine |
| SMILES | COc1ccc2nc(C(C)Cl)n(CCCS(C)(=O)=O)c2n1 |
| InChI | InChI=1S/C13H18ClN3O3S/c1-9(14)12-15-10-5-6-11(20-2)16-13(10)17(12)7-4-8-21(3,18)19/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | RTUSPZLSEYCGIK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|