C14H19ClN4O2 — CID 106278723
3-[2-(1-chloroethyl)-5-methoxyimidazo[4,5-b]pyridin-3-yl]-2,2-dimethylpropanamide (PubChem CID 106278723) has the molecular formula C14H19ClN4O2 and a molecular weight of 310.79 g/mol. Its IUPAC name is 3-[2-(1-chloroethyl)-5-methoxyimidazo[4,5-b]pyridin-3-yl]-2,2-dimethylpropanamide.
| Compound Name | 3-[2-(1-chloroethyl)-5-methoxyimidazo[4,5-b]pyridin-3-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106278723 |
| Molecular Formula | C14H19ClN4O2 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 3-[2-(1-chloroethyl)-5-methoxyimidazo[4,5-b]pyridin-3-yl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc2nc(C(C)Cl)n(CC(C)(C)C(N)=O)c2n1 |
| InChI | InChI=1S/C14H19ClN4O2/c1-8(15)11-17-9-5-6-10(21-4)18-12(9)19(11)7-14(2,3)13(16)20/h5-6,8H,7H2,1-4H3,(H2,16,20) |
| InChIKey | WRMPFXJZWGOIFF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|