C14H17Cl2N3O — CID 106278774
3-[6-chloro-2-(1-chloroethyl)benzimidazol-1-yl]-2,2-dimethylpropanamide (PubChem CID 106278774) has the molecular formula C14H17Cl2N3O and a molecular weight of 314.22 g/mol. Its IUPAC name is 3-[6-chloro-2-(1-chloroethyl)benzimidazol-1-yl]-2,2-dimethylpropanamide.
| Compound Name | 3-[6-chloro-2-(1-chloroethyl)benzimidazol-1-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106278774 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-[6-chloro-2-(1-chloroethyl)benzimidazol-1-yl]-2,2-dimethylpropanamide |
| SMILES | CC(Cl)c1nc2ccc(Cl)cc2n1CC(C)(C)C(N)=O |
| InChI | InChI=1S/C14H17Cl2N3O/c1-8(15)12-18-10-5-4-9(16)6-11(10)19(12)7-14(2,3)13(17)20/h4-6,8H,7H2,1-3H3,(H2,17,20) |
| InChIKey | MLCQOIZREUPYQT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|