C15H17ClN4O — CID 106278756
3-[2-(1-chloroethyl)-4-cyanobenzimidazol-1-yl]-2,2-dimethylpropanamide (PubChem CID 106278756) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is 3-[2-(1-chloroethyl)-4-cyanobenzimidazol-1-yl]-2,2-dimethylpropanamide.
| Compound Name | 3-[2-(1-chloroethyl)-4-cyanobenzimidazol-1-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106278756 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3-[2-(1-chloroethyl)-4-cyanobenzimidazol-1-yl]-2,2-dimethylpropanamide |
| SMILES | CC(Cl)c1nc2c(C#N)cccc2n1CC(C)(C)C(N)=O |
| InChI | InChI=1S/C15H17ClN4O/c1-9(16)13-19-12-10(7-17)5-4-6-11(12)20(13)8-15(2,3)14(18)21/h4-6,9H,8H2,1-3H3,(H2,18,21) |
| InChIKey | QXXYKKRBQCDMOY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|