C20H29ClN6O4 — CID 110175186
[2-hydroxy-3-[8-(2-hydroxyethylamino)-1,3-dimethyl-2,6-dioxopurin-7-yl]propyl]-(2-phenylethyl)azanium chloride (PubChem CID 110175186) has the molecular formula C20H29ClN6O4 and a molecular weight of 452.94 g/mol. Its IUPAC name is [2-hydroxy-3-[8-(2-hydroxyethylamino)-1,3-dimethyl-2,6-dioxopurin-7-yl]propyl]-(2-phenylethyl)azanium chloride.
| Compound Name | [2-hydroxy-3-[8-(2-hydroxyethylamino)-1,3-dimethyl-2,6-dioxopurin-7-yl]propyl]-(2-phenylethyl)azanium chloride |
|---|---|
| PubChem CID | 110175186 |
| Molecular Formula | C20H29ClN6O4 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | [2-hydroxy-3-[8-(2-hydroxyethylamino)-1,3-dimethyl-2,6-dioxopurin-7-yl]propyl]-(2-phenylethyl)azanium chloride |
| SMILES | Cn1c(=O)c2c(nc(NCCO)n2CC(O)C[NH2+]CCc2ccccc2)n(C)c1=O.[Cl-] |
| InChI | InChI=1S/C20H28N6O4.ClH/c1-24-17-16(18(29)25(2)20(24)30)26(19(23-17)22-10-11-27)13-15(28)12-21-9-8-14-6-4-3-5-7-14;/h3-7,15,21,27-28H,8-13H2,1-2H3,(H,22,23);1H |
| InChIKey | YUXYIEMGLKRXHZ-UHFFFAOYSA-N |
| XLogP | -4.99 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | -4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|